About diphenyl carbonate;2-[4-[9-[4-(2-hydroxyethoxy)phenyl]fluoren-9-yl]phenoxy]ethanol
diphenyl carbonate;2-[4-[9-[4-(2-hydroxyethoxy)phenyl]fluoren-9-yl]phenoxy]ethanol (PubChem CID 137499054) has the molecular formula C42H36O7
and a molecular weight of 652.74 g/mol. Its IUPAC name is diphenyl carbonate;2-[4-[9-[4-(2-hydroxyethoxy)phenyl]fluoren-9-yl]phenoxy]ethanol.
Molecular Properties
| Compound Name | diphenyl carbonate;2-[4-[9-[4-(2-hydroxyethoxy)phenyl]fluoren-9-yl]phenoxy]ethanol |
| PubChem CID | 137499054 |
| Molecular Formula | C42H36O7 |
| Molecular Weight | 652.74 g/mol |
| Exact Mass | 652.25 |
| IUPAC Name | diphenyl carbonate;2-[4-[9-[4-(2-hydroxyethoxy)phenyl]fluoren-9-yl]phenoxy]ethanol |
| SMILES | O=C(Oc1ccccc1)Oc1ccccc1.OCCOc1ccc(C2(c3ccc(OCCO)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C29H26O4.C13H10O3/c30-17-19-32-23-13-9-21(10-14-23)29(22-11-15-24(16-12-22)33-20-18-31)27-7-3-1-5-25(27)26-6-2-4-8-28(26)29;14-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12/h1-16,30-31H,17-20H2;1-10H |
| InChIKey | FAXHBQTVJOERGZ-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 652.74 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze diphenyl carbonate;2-[4-[9-[4-(2-hydroxyethoxy)phenyl]fluoren-9-yl]phenoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl carbonate;2-[4-[9-[4-(2-hydroxyethoxy)phenyl]fluoren-9-yl]phenoxy]ethanol?
The IUPAC name of diphenyl carbonate;2-[4-[9-[4-(2-hydroxyethoxy)phenyl]fluoren-9-yl]phenoxy]ethanol (CID 137499054) is diphenyl carbonate;2-[4-[9-[4-(2-hydroxyethoxy)phenyl]fluoren-9-yl]phenoxy]ethanol.
What is the SMILES notation for diphenyl carbonate;2-[4-[9-[4-(2-hydroxyethoxy)phenyl]fluoren-9-yl]phenoxy]ethanol?
The canonical SMILES for diphenyl carbonate;2-[4-[9-[4-(2-hydroxyethoxy)phenyl]fluoren-9-yl]phenoxy]ethanol is O=C(Oc1ccccc1)Oc1ccccc1.OCCOc1ccc(C2(c3ccc(OCCO)cc3)c3ccccc3-c3ccccc32)cc1.
What is the InChIKey of diphenyl carbonate;2-[4-[9-[4-(2-hydroxyethoxy)phenyl]fluoren-9-yl]phenoxy]ethanol?
The InChIKey is FAXHBQTVJOERGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H26O4.C13H10O3/c30-17-19-32-23-13-9-21(10-14-23)29(22-11-15-24(16-12-22)33-20-18-31)27-7-3-1-5-25(27)26-6-2-4-8-28(26)29;14-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12/h1-16,30-31H,17-20H2;1-10H.
What are the key properties of diphenyl carbonate;2-[4-[9-[4-(2-hydroxyethoxy)phenyl]fluoren-9-yl]phenoxy]ethanol?
diphenyl carbonate;2-[4-[9-[4-(2-hydroxyethoxy)phenyl]fluoren-9-yl]phenoxy]ethanol has a molecular weight of 652.74 g/mol, XLogP of 8.06, 10 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl carbonate;2-[4-[9-[4-(2-hydroxyethoxy)phenyl]fluoren-9-yl]phenoxy]ethanol is sourced from PubChem (CID 137499054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).