About 3-chloro-5-[2-[4-(1,1-difluoroethyl)phenoxy]-3-pyridinyl]-4-methylpyridine
3-chloro-5-[2-[4-(1,1-difluoroethyl)phenoxy]-3-pyridinyl]-4-methylpyridine (PubChem CID 137499148) has the molecular formula C19H15ClF2N2O
and a molecular weight of 360.79 g/mol. Its IUPAC name is 3-chloro-5-[2-[4-(1,1-difluoroethyl)phenoxy]-3-pyridinyl]-4-methylpyridine.
Molecular Properties
| Compound Name | 3-chloro-5-[2-[4-(1,1-difluoroethyl)phenoxy]-3-pyridinyl]-4-methylpyridine |
| PubChem CID | 137499148 |
| Molecular Formula | C19H15ClF2N2O |
| Molecular Weight | 360.79 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 3-chloro-5-[2-[4-(1,1-difluoroethyl)phenoxy]-3-pyridinyl]-4-methylpyridine |
| SMILES | Cc1c(Cl)cncc1-c1cccnc1Oc1ccc(C(C)(F)F)cc1 |
| InChI | InChI=1S/C19H15ClF2N2O/c1-12-16(10-23-11-17(12)20)15-4-3-9-24-18(15)25-14-7-5-13(6-8-14)19(2,21)22/h3-11H,1-2H3 |
| InChIKey | UXRSTCAKZQRHBB-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.79 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-5-[2-[4-(1,1-difluoroethyl)phenoxy]-3-pyridinyl]-4-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-[2-[4-(1,1-difluoroethyl)phenoxy]-3-pyridinyl]-4-methylpyridine?
The IUPAC name of 3-chloro-5-[2-[4-(1,1-difluoroethyl)phenoxy]-3-pyridinyl]-4-methylpyridine (CID 137499148) is 3-chloro-5-[2-[4-(1,1-difluoroethyl)phenoxy]-3-pyridinyl]-4-methylpyridine.
What is the SMILES notation for 3-chloro-5-[2-[4-(1,1-difluoroethyl)phenoxy]-3-pyridinyl]-4-methylpyridine?
The canonical SMILES for 3-chloro-5-[2-[4-(1,1-difluoroethyl)phenoxy]-3-pyridinyl]-4-methylpyridine is Cc1c(Cl)cncc1-c1cccnc1Oc1ccc(C(C)(F)F)cc1.
What is the InChIKey of 3-chloro-5-[2-[4-(1,1-difluoroethyl)phenoxy]-3-pyridinyl]-4-methylpyridine?
The InChIKey is UXRSTCAKZQRHBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15ClF2N2O/c1-12-16(10-23-11-17(12)20)15-4-3-9-24-18(15)25-14-7-5-13(6-8-14)19(2,21)22/h3-11H,1-2H3.
What are the key properties of 3-chloro-5-[2-[4-(1,1-difluoroethyl)phenoxy]-3-pyridinyl]-4-methylpyridine?
3-chloro-5-[2-[4-(1,1-difluoroethyl)phenoxy]-3-pyridinyl]-4-methylpyridine has a molecular weight of 360.79 g/mol, XLogP of 6.01, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-[2-[4-(1,1-difluoroethyl)phenoxy]-3-pyridinyl]-4-methylpyridine is sourced from PubChem (CID 137499148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).