C13H11F6NO — CID 137499390
4,4,4-trifluoro-1-[3-(3,4,5-trifluorophenyl)azetidin-1-yl]butan-1-one (PubChem CID 137499390) has the molecular formula C13H11F6NO and a molecular weight of 311.23 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-[3-(3,4,5-trifluorophenyl)azetidin-1-yl]butan-1-one.
| Compound Name | 4,4,4-trifluoro-1-[3-(3,4,5-trifluorophenyl)azetidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 137499390 |
| Molecular Formula | C13H11F6NO |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 4,4,4-trifluoro-1-[3-(3,4,5-trifluorophenyl)azetidin-1-yl]butan-1-one |
| SMILES | O=C(CCC(F)(F)F)N1CC(c2cc(F)c(F)c(F)c2)C1 |
| InChI | InChI=1S/C13H11F6NO/c14-9-3-7(4-10(15)12(9)16)8-5-20(6-8)11(21)1-2-13(17,18)19/h3-4,8H,1-2,5-6H2 |
| InChIKey | HEUQKTIGWVXISV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|