About ethyl 3-[[2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylate
ethyl 3-[[2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylate (PubChem CID 137499537) has the molecular formula C20H28N4O5S
and a molecular weight of 436.53 g/mol. Its IUPAC name is ethyl 3-[[2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-[[2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylate |
| PubChem CID | 137499537 |
| Molecular Formula | C20H28N4O5S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | ethyl 3-[[2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(S(=O)(=O)NC(=O)Nc2c(C(C)C)cccc2C(C)C)nn1C |
| InChI | InChI=1S/C20H28N4O5S/c1-7-29-19(25)16-11-17(22-24(16)6)30(27,28)23-20(26)21-18-14(12(2)3)9-8-10-15(18)13(4)5/h8-13H,7H2,1-6H3,(H2,21,23,26) |
| InChIKey | ZCDZUPNYLCURAD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 3-[[2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[[2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylate?
The IUPAC name of ethyl 3-[[2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylate (CID 137499537) is ethyl 3-[[2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylate.
What is the SMILES notation for ethyl 3-[[2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylate?
The canonical SMILES for ethyl 3-[[2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylate is CCOC(=O)c1cc(S(=O)(=O)NC(=O)Nc2c(C(C)C)cccc2C(C)C)nn1C.
What is the InChIKey of ethyl 3-[[2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylate?
The InChIKey is ZCDZUPNYLCURAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N4O5S/c1-7-29-19(25)16-11-17(22-24(16)6)30(27,28)23-20(26)21-18-14(12(2)3)9-8-10-15(18)13(4)5/h8-13H,7H2,1-6H3,(H2,21,23,26).
What are the key properties of ethyl 3-[[2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylate?
ethyl 3-[[2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylate has a molecular weight of 436.53 g/mol, XLogP of 3.35, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[[2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylate is sourced from PubChem (CID 137499537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).