About 3-[[4-fluoro-2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylic acid
3-[[4-fluoro-2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylic acid (PubChem CID 137499575) has the molecular formula C18H23FN4O5S
and a molecular weight of 426.47 g/mol. Its IUPAC name is 3-[[4-fluoro-2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 3-[[4-fluoro-2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylic acid |
| PubChem CID | 137499575 |
| Molecular Formula | C18H23FN4O5S |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 3-[[4-fluoro-2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylic acid |
| SMILES | CC(C)c1cc(F)cc(C(C)C)c1NC(=O)NS(=O)(=O)c1cc(C(=O)O)n(C)n1 |
| InChI | InChI=1S/C18H23FN4O5S/c1-9(2)12-6-11(19)7-13(10(3)4)16(12)20-18(26)22-29(27,28)15-8-14(17(24)25)23(5)21-15/h6-10H,1-5H3,(H,24,25)(H2,20,22,26) |
| InChIKey | KRDWOVKKEWIURF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[4-fluoro-2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-fluoro-2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylic acid?
The IUPAC name of 3-[[4-fluoro-2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylic acid (CID 137499575) is 3-[[4-fluoro-2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylic acid.
What is the SMILES notation for 3-[[4-fluoro-2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylic acid?
The canonical SMILES for 3-[[4-fluoro-2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylic acid is CC(C)c1cc(F)cc(C(C)C)c1NC(=O)NS(=O)(=O)c1cc(C(=O)O)n(C)n1.
What is the InChIKey of 3-[[4-fluoro-2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylic acid?
The InChIKey is KRDWOVKKEWIURF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23FN4O5S/c1-9(2)12-6-11(19)7-13(10(3)4)16(12)20-18(26)22-29(27,28)15-8-14(17(24)25)23(5)21-15/h6-10H,1-5H3,(H,24,25)(H2,20,22,26).
What are the key properties of 3-[[4-fluoro-2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylic acid?
3-[[4-fluoro-2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylic acid has a molecular weight of 426.47 g/mol, XLogP of 3.01, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-fluoro-2,6-di(propan-2-yl)phenyl]carbamoylsulfamoyl]-1-methylpyrazole-5-carboxylic acid is sourced from PubChem (CID 137499575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).