About (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-(3-ethylphenyl)methanol
(2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-(3-ethylphenyl)methanol (PubChem CID 137499621) has the molecular formula C17H18N2OS
and a molecular weight of 298.41 g/mol. Its IUPAC name is (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-(3-ethylphenyl)methanol.
Molecular Properties
| Compound Name | (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-(3-ethylphenyl)methanol |
| PubChem CID | 137499621 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-(3-ethylphenyl)methanol |
| SMILES | CCc1cccc(C(O)c2c(C3CC3)sc3cncn23)c1 |
| InChI | InChI=1S/C17H18N2OS/c1-2-11-4-3-5-13(8-11)16(20)15-17(12-6-7-12)21-14-9-18-10-19(14)15/h3-5,8-10,12,16,20H,2,6-7H2,1H3 |
| InChIKey | BXYVAMGVOUNHJX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-(3-ethylphenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-(3-ethylphenyl)methanol?
The IUPAC name of (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-(3-ethylphenyl)methanol (CID 137499621) is (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-(3-ethylphenyl)methanol.
What is the SMILES notation for (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-(3-ethylphenyl)methanol?
The canonical SMILES for (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-(3-ethylphenyl)methanol is CCc1cccc(C(O)c2c(C3CC3)sc3cncn23)c1.
What is the InChIKey of (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-(3-ethylphenyl)methanol?
The InChIKey is BXYVAMGVOUNHJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2OS/c1-2-11-4-3-5-13(8-11)16(20)15-17(12-6-7-12)21-14-9-18-10-19(14)15/h3-5,8-10,12,16,20H,2,6-7H2,1H3.
What are the key properties of (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-(3-ethylphenyl)methanol?
(2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-(3-ethylphenyl)methanol has a molecular weight of 298.41 g/mol, XLogP of 3.92, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-(3-ethylphenyl)methanol is sourced from PubChem (CID 137499621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).