About 3-(4-pyrazin-2-ylpyridazin-1-ium-1-yl)propanoic acid;2,2,2-trifluoroacetate
3-(4-pyrazin-2-ylpyridazin-1-ium-1-yl)propanoic acid;2,2,2-trifluoroacetate (PubChem CID 137499781) has the molecular formula C13H11F3N4O4
and a molecular weight of 344.25 g/mol. Its IUPAC name is 3-(4-pyrazin-2-ylpyridazin-1-ium-1-yl)propanoic acid;2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | 3-(4-pyrazin-2-ylpyridazin-1-ium-1-yl)propanoic acid;2,2,2-trifluoroacetate |
| PubChem CID | 137499781 |
| Molecular Formula | C13H11F3N4O4 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 3-(4-pyrazin-2-ylpyridazin-1-ium-1-yl)propanoic acid;2,2,2-trifluoroacetate |
| SMILES | O=C(O)CC[n+]1ccc(-c2cnccn2)cn1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C11H10N4O2.C2HF3O2/c16-11(17)2-6-15-5-1-9(7-14-15)10-8-12-3-4-13-10;3-2(4,5)1(6)7/h1,3-5,7-8H,2,6H2;(H,6,7) |
| InChIKey | BZZWXMCPDYEASM-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 119.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-pyrazin-2-ylpyridazin-1-ium-1-yl)propanoic acid;2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-pyrazin-2-ylpyridazin-1-ium-1-yl)propanoic acid;2,2,2-trifluoroacetate?
The IUPAC name of 3-(4-pyrazin-2-ylpyridazin-1-ium-1-yl)propanoic acid;2,2,2-trifluoroacetate (CID 137499781) is 3-(4-pyrazin-2-ylpyridazin-1-ium-1-yl)propanoic acid;2,2,2-trifluoroacetate.
What is the SMILES notation for 3-(4-pyrazin-2-ylpyridazin-1-ium-1-yl)propanoic acid;2,2,2-trifluoroacetate?
The canonical SMILES for 3-(4-pyrazin-2-ylpyridazin-1-ium-1-yl)propanoic acid;2,2,2-trifluoroacetate is O=C(O)CC[n+]1ccc(-c2cnccn2)cn1.O=C([O-])C(F)(F)F.
What is the InChIKey of 3-(4-pyrazin-2-ylpyridazin-1-ium-1-yl)propanoic acid;2,2,2-trifluoroacetate?
The InChIKey is BZZWXMCPDYEASM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4O2.C2HF3O2/c16-11(17)2-6-15-5-1-9(7-14-15)10-8-12-3-4-13-10;3-2(4,5)1(6)7/h1,3-5,7-8H,2,6H2;(H,6,7).
What are the key properties of 3-(4-pyrazin-2-ylpyridazin-1-ium-1-yl)propanoic acid;2,2,2-trifluoroacetate?
3-(4-pyrazin-2-ylpyridazin-1-ium-1-yl)propanoic acid;2,2,2-trifluoroacetate has a molecular weight of 344.25 g/mol, XLogP of -0.40, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-pyrazin-2-ylpyridazin-1-ium-1-yl)propanoic acid;2,2,2-trifluoroacetate is sourced from PubChem (CID 137499781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).