C16H15F6N5O6 — CID 137499790
[(1S)-1-carboxy-3-(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)propyl]azanium;bis(2,2,2-trifluoroacetate) (PubChem CID 137499790) has the molecular formula C16H15F6N5O6 and a molecular weight of 487.31 g/mol. Its IUPAC name is [(1S)-1-carboxy-3-(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)propyl]azanium;bis(2,2,2-trifluoroacetate).
| Compound Name | [(1S)-1-carboxy-3-(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)propyl]azanium;bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 137499790 |
| Molecular Formula | C16H15F6N5O6 |
| Molecular Weight | 487.31 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | [(1S)-1-carboxy-3-(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)propyl]azanium;bis(2,2,2-trifluoroacetate) |
| SMILES | O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F.[NH3+][C@@H](CC[n+]1ccc(-c2ncccn2)cn1)C(=O)O |
| InChI | InChI=1S/C12H13N5O2.2C2HF3O2/c13-10(12(18)19)3-7-17-6-2-9(8-16-17)11-14-4-1-5-15-11;2*3-2(4,5)1(6)7/h1-2,4-6,8,10H,3,7,13H2;2*(H,6,7)/t10-;;/m0../s1 |
| InChIKey | HWKDPRUKGOKOEU-XRIOVQLTSA-N |
| XLogP | -2.49 |
| TPSA | 187.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.31 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|