C13H13F3N5O4+ — CID 137499817
(2S)-2-amino-3-(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 137499817) has the molecular formula C13H13F3N5O4+ and a molecular weight of 360.27 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-amino-3-(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 137499817 |
| Molecular Formula | C13H13F3N5O4+ |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | (2S)-2-amino-3-(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | N[C@@H](C[n+]1ccc(-c2ncccn2)cn1)C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H11N5O2.C2HF3O2/c12-9(11(17)18)7-16-5-2-8(6-15-16)10-13-3-1-4-14-10;3-2(4,5)1(6)7/h1-6,9H,7,12H2;(H,6,7)/p+1/t9-;/m0./s1 |
| InChIKey | PDILKYIPPHLLLX-FVGYRXGTSA-O |
| XLogP | -0.13 |
| TPSA | 143.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|