C16H19F3N5O4+ — CID 137499826
methyl (2S)-2-amino-5-(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)pentanoate;2,2,2-trifluoroacetic acid (PubChem CID 137499826) has the molecular formula C16H19F3N5O4+ and a molecular weight of 402.35 g/mol. Its IUPAC name is methyl (2S)-2-amino-5-(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)pentanoate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl (2S)-2-amino-5-(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)pentanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 137499826 |
| Molecular Formula | C16H19F3N5O4+ |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | methyl (2S)-2-amino-5-(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)pentanoate;2,2,2-trifluoroacetic acid |
| SMILES | COC(=O)[C@@H](N)CCC[n+]1ccc(-c2ncccn2)cn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H18N5O2.C2HF3O2/c1-21-14(20)12(15)4-2-8-19-9-5-11(10-18-19)13-16-6-3-7-17-13;3-2(4,5)1(6)7/h3,5-7,9-10,12H,2,4,8,15H2,1H3;(H,6,7)/q+1;/t12-;/m0./s1 |
| InChIKey | QSRLHVPPYHJMPW-YDALLXLXSA-N |
| XLogP | 0.74 |
| TPSA | 132.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|