About (2,2,2-trifluoroacetyl) 3-[4-(5-chloro-6-oxo-1H-pyrimidin-2-yl)pyridazin-1-ium-1-yl]propanoate
(2,2,2-trifluoroacetyl) 3-[4-(5-chloro-6-oxo-1H-pyrimidin-2-yl)pyridazin-1-ium-1-yl]propanoate (PubChem CID 137499845) has the molecular formula C13H9ClF3N4O4+
and a molecular weight of 377.69 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-[4-(5-chloro-6-oxo-1H-pyrimidin-2-yl)pyridazin-1-ium-1-yl]propanoate.
Molecular Properties
| Compound Name | (2,2,2-trifluoroacetyl) 3-[4-(5-chloro-6-oxo-1H-pyrimidin-2-yl)pyridazin-1-ium-1-yl]propanoate |
| PubChem CID | 137499845 |
| Molecular Formula | C13H9ClF3N4O4+ |
| Molecular Weight | 377.69 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-[4-(5-chloro-6-oxo-1H-pyrimidin-2-yl)pyridazin-1-ium-1-yl]propanoate |
| SMILES | O=C(CC[n+]1ccc(-c2ncc(Cl)c(=O)[nH]2)cn1)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H8ClF3N4O4/c14-8-6-18-10(20-11(8)23)7-1-3-21(19-5-7)4-2-9(22)25-12(24)13(15,16)17/h1,3,5-6H,2,4H2/p+1 |
| InChIKey | KXLDYCRSAMGBJE-UHFFFAOYSA-O |
| XLogP | 0.80 |
| TPSA | 105.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.69 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (2,2,2-trifluoroacetyl) 3-[4-(5-chloro-6-oxo-1H-pyrimidin-2-yl)pyridazin-1-ium-1-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2,2-trifluoroacetyl) 3-[4-(5-chloro-6-oxo-1H-pyrimidin-2-yl)pyridazin-1-ium-1-yl]propanoate?
The IUPAC name of (2,2,2-trifluoroacetyl) 3-[4-(5-chloro-6-oxo-1H-pyrimidin-2-yl)pyridazin-1-ium-1-yl]propanoate (CID 137499845) is (2,2,2-trifluoroacetyl) 3-[4-(5-chloro-6-oxo-1H-pyrimidin-2-yl)pyridazin-1-ium-1-yl]propanoate.
What is the SMILES notation for (2,2,2-trifluoroacetyl) 3-[4-(5-chloro-6-oxo-1H-pyrimidin-2-yl)pyridazin-1-ium-1-yl]propanoate?
The canonical SMILES for (2,2,2-trifluoroacetyl) 3-[4-(5-chloro-6-oxo-1H-pyrimidin-2-yl)pyridazin-1-ium-1-yl]propanoate is O=C(CC[n+]1ccc(-c2ncc(Cl)c(=O)[nH]2)cn1)OC(=O)C(F)(F)F.
What is the InChIKey of (2,2,2-trifluoroacetyl) 3-[4-(5-chloro-6-oxo-1H-pyrimidin-2-yl)pyridazin-1-ium-1-yl]propanoate?
The InChIKey is KXLDYCRSAMGBJE-UHFFFAOYSA-O. The full InChI is InChI=1S/C13H8ClF3N4O4/c14-8-6-18-10(20-11(8)23)7-1-3-21(19-5-7)4-2-9(22)25-12(24)13(15,16)17/h1,3,5-6H,2,4H2/p+1.
What are the key properties of (2,2,2-trifluoroacetyl) 3-[4-(5-chloro-6-oxo-1H-pyrimidin-2-yl)pyridazin-1-ium-1-yl]propanoate?
(2,2,2-trifluoroacetyl) 3-[4-(5-chloro-6-oxo-1H-pyrimidin-2-yl)pyridazin-1-ium-1-yl]propanoate has a molecular weight of 377.69 g/mol, XLogP of 0.80, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2,2-trifluoroacetyl) 3-[4-(5-chloro-6-oxo-1H-pyrimidin-2-yl)pyridazin-1-ium-1-yl]propanoate is sourced from PubChem (CID 137499845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).