About (2R)-6-(1-amino-2,2-difluoroethyl)-2-methyloxan-3-amine
(2R)-6-(1-amino-2,2-difluoroethyl)-2-methyloxan-3-amine (PubChem CID 137530929) has the molecular formula C8H16F2N2O
and a molecular weight of 194.22 g/mol. Its IUPAC name is (2R)-6-(1-amino-2,2-difluoroethyl)-2-methyloxan-3-amine.
Molecular Properties
| Compound Name | (2R)-6-(1-amino-2,2-difluoroethyl)-2-methyloxan-3-amine |
| PubChem CID | 137530929 |
| Molecular Formula | C8H16F2N2O |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | (2R)-6-(1-amino-2,2-difluoroethyl)-2-methyloxan-3-amine |
| SMILES | C[C@@H]1C(CCC(O1)C(C(F)F)N)N |
| InChI | InChI=1S/C8H16F2N2O/c1-4-5(11)2-3-6(13-4)7(12)8(9)10/h4-8H,2-3,11-12H2,1H3/t4-,5?,6?,7?/m1/s1 |
| InChIKey | BUHVTNYRFMJKKG-BJMCJPPVSA-N |
| XLogP | 0.20 |
| TPSA | 61.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | 168 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-6-(1-amino-2,2-difluoroethyl)-2-methyloxan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-6-(1-amino-2,2-difluoroethyl)-2-methyloxan-3-amine?
The IUPAC name of (2R)-6-(1-amino-2,2-difluoroethyl)-2-methyloxan-3-amine (CID 137530929) is (2R)-6-(1-amino-2,2-difluoroethyl)-2-methyloxan-3-amine.
What is the SMILES notation for (2R)-6-(1-amino-2,2-difluoroethyl)-2-methyloxan-3-amine?
The canonical SMILES for (2R)-6-(1-amino-2,2-difluoroethyl)-2-methyloxan-3-amine is C[C@@H]1C(CCC(O1)C(C(F)F)N)N.
What is the InChIKey of (2R)-6-(1-amino-2,2-difluoroethyl)-2-methyloxan-3-amine?
The InChIKey is BUHVTNYRFMJKKG-BJMCJPPVSA-N. The full InChI is InChI=1S/C8H16F2N2O/c1-4-5(11)2-3-6(13-4)7(12)8(9)10/h4-8H,2-3,11-12H2,1H3/t4-,5?,6?,7?/m1/s1.
What are the key properties of (2R)-6-(1-amino-2,2-difluoroethyl)-2-methyloxan-3-amine?
(2R)-6-(1-amino-2,2-difluoroethyl)-2-methyloxan-3-amine has a molecular weight of 194.22 g/mol, XLogP of 0.20, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-6-(1-amino-2,2-difluoroethyl)-2-methyloxan-3-amine is sourced from PubChem (CID 137530929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).