About 3-ethyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one
3-ethyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one (PubChem CID 1375769) has the molecular formula C8H9N3OS2
and a molecular weight of 227.31 g/mol. Its IUPAC name is 3-ethyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 3-ethyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one |
| PubChem CID | 1375769 |
| Molecular Formula | C8H9N3OS2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.02 |
| IUPAC Name | 3-ethyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)CSC1=Nc1nccs1 |
| InChI | InChI=1S/C8H9N3OS2/c1-2-11-6(12)5-14-8(11)10-7-9-3-4-13-7/h3-4H,2,5H2,1H3 |
| InChIKey | KDKRMLDEGWORKL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one?
The IUPAC name of 3-ethyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one (CID 1375769) is 3-ethyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one.
What is the SMILES notation for 3-ethyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one?
The canonical SMILES for 3-ethyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one is CCN1C(=O)CSC1=Nc1nccs1.
What is the InChIKey of 3-ethyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one?
The InChIKey is KDKRMLDEGWORKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3OS2/c1-2-11-6(12)5-14-8(11)10-7-9-3-4-13-7/h3-4H,2,5H2,1H3.
What are the key properties of 3-ethyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one?
3-ethyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one has a molecular weight of 227.31 g/mol, XLogP of 1.73, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one is sourced from PubChem (CID 1375769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).