C8H8F6N4OS2 — CID 1375895
1-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)urea (PubChem CID 1375895) has the molecular formula C8H8F6N4OS2 and a molecular weight of 354.30 g/mol. Its IUPAC name is 1-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)urea.
| Compound Name | 1-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)urea |
|---|---|
| PubChem CID | 1375895 |
| Molecular Formula | C8H8F6N4OS2 |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 1-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)urea |
| SMILES | CCSc1nnc(NC(=O)NC(C(F)(F)F)C(F)(F)F)s1 |
| InChI | InChI=1S/C8H8F6N4OS2/c1-2-20-6-18-17-5(21-6)16-4(19)15-3(7(9,10)11)8(12,13)14/h3H,2H2,1H3,(H2,15,16,17,19) |
| InChIKey | WIWCUOOKIIZFAQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|