About (1E)-1-(2-methoxyindol-3-ylidene)-N,N-dimethylmethanamine
(1E)-1-(2-methoxyindol-3-ylidene)-N,N-dimethylmethanamine (PubChem CID 1375900) has the molecular formula C12H14N2O
and a molecular weight of 202.26 g/mol. Its IUPAC name is (1E)-1-(2-methoxyindol-3-ylidene)-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | (1E)-1-(2-methoxyindol-3-ylidene)-N,N-dimethylmethanamine |
| PubChem CID | 1375900 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | (1E)-1-(2-methoxyindol-3-ylidene)-N,N-dimethylmethanamine |
| SMILES | COC1=Nc2ccccc2/C1=C\N(C)C |
| InChI | InChI=1S/C12H14N2O/c1-14(2)8-10-9-6-4-5-7-11(9)13-12(10)15-3/h4-8H,1-3H3/b10-8+ |
| InChIKey | QNKUGDDHXMYMHC-CSKARUKUSA-N |
| XLogP | 2.28 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1E)-1-(2-methoxyindol-3-ylidene)-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-(2-methoxyindol-3-ylidene)-N,N-dimethylmethanamine?
The IUPAC name of (1E)-1-(2-methoxyindol-3-ylidene)-N,N-dimethylmethanamine (CID 1375900) is (1E)-1-(2-methoxyindol-3-ylidene)-N,N-dimethylmethanamine.
What is the SMILES notation for (1E)-1-(2-methoxyindol-3-ylidene)-N,N-dimethylmethanamine?
The canonical SMILES for (1E)-1-(2-methoxyindol-3-ylidene)-N,N-dimethylmethanamine is COC1=Nc2ccccc2/C1=C\N(C)C.
What is the InChIKey of (1E)-1-(2-methoxyindol-3-ylidene)-N,N-dimethylmethanamine?
The InChIKey is QNKUGDDHXMYMHC-CSKARUKUSA-N. The full InChI is InChI=1S/C12H14N2O/c1-14(2)8-10-9-6-4-5-7-11(9)13-12(10)15-3/h4-8H,1-3H3/b10-8+.
What are the key properties of (1E)-1-(2-methoxyindol-3-ylidene)-N,N-dimethylmethanamine?
(1E)-1-(2-methoxyindol-3-ylidene)-N,N-dimethylmethanamine has a molecular weight of 202.26 g/mol, XLogP of 2.28, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-(2-methoxyindol-3-ylidene)-N,N-dimethylmethanamine is sourced from PubChem (CID 1375900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).