About 2-[(4-benzylpiperazin-1-yl)methyl]-4,6-dichlorophenol
2-[(4-benzylpiperazin-1-yl)methyl]-4,6-dichlorophenol (PubChem CID 1376190) has the molecular formula C18H20Cl2N2O
and a molecular weight of 351.28 g/mol. Its IUPAC name is 2-[(4-benzylpiperazin-1-yl)methyl]-4,6-dichlorophenol.
Molecular Properties
| Compound Name | 2-[(4-benzylpiperazin-1-yl)methyl]-4,6-dichlorophenol |
| PubChem CID | 1376190 |
| Molecular Formula | C18H20Cl2N2O |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 2-[(4-benzylpiperazin-1-yl)methyl]-4,6-dichlorophenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1CN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H20Cl2N2O/c19-16-10-15(18(23)17(20)11-16)13-22-8-6-21(7-9-22)12-14-4-2-1-3-5-14/h1-5,10-11,23H,6-9,12-13H2 |
| InChIKey | DBGOOXXHYOZWGV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-benzylpiperazin-1-yl)methyl]-4,6-dichlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-benzylpiperazin-1-yl)methyl]-4,6-dichlorophenol?
The IUPAC name of 2-[(4-benzylpiperazin-1-yl)methyl]-4,6-dichlorophenol (CID 1376190) is 2-[(4-benzylpiperazin-1-yl)methyl]-4,6-dichlorophenol.
What is the SMILES notation for 2-[(4-benzylpiperazin-1-yl)methyl]-4,6-dichlorophenol?
The canonical SMILES for 2-[(4-benzylpiperazin-1-yl)methyl]-4,6-dichlorophenol is Oc1c(Cl)cc(Cl)cc1CN1CCN(Cc2ccccc2)CC1.
What is the InChIKey of 2-[(4-benzylpiperazin-1-yl)methyl]-4,6-dichlorophenol?
The InChIKey is DBGOOXXHYOZWGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20Cl2N2O/c19-16-10-15(18(23)17(20)11-16)13-22-8-6-21(7-9-22)12-14-4-2-1-3-5-14/h1-5,10-11,23H,6-9,12-13H2.
What are the key properties of 2-[(4-benzylpiperazin-1-yl)methyl]-4,6-dichlorophenol?
2-[(4-benzylpiperazin-1-yl)methyl]-4,6-dichlorophenol has a molecular weight of 351.28 g/mol, XLogP of 4.02, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-benzylpiperazin-1-yl)methyl]-4,6-dichlorophenol is sourced from PubChem (CID 1376190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).