C19H22INO4 — CID 1376220
4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-2-iodo-6-methoxyphenol (PubChem CID 1376220) has the molecular formula C19H22INO4 and a molecular weight of 455.29 g/mol. Its IUPAC name is 4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-2-iodo-6-methoxyphenol.
| Compound Name | 4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-2-iodo-6-methoxyphenol |
|---|---|
| PubChem CID | 1376220 |
| Molecular Formula | C19H22INO4 |
| Molecular Weight | 455.29 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | 4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-2-iodo-6-methoxyphenol |
| SMILES | COc1cc2c(cc1OC)CN(Cc1cc(I)c(O)c(OC)c1)CC2 |
| InChI | InChI=1S/C19H22INO4/c1-23-16-8-13-4-5-21(11-14(13)9-17(16)24-2)10-12-6-15(20)19(22)18(7-12)25-3/h6-9,22H,4-5,10-11H2,1-3H3 |
| InChIKey | LQYMVZJOCBNOLZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.29 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|