C23H20ClN3O2 — CID 137630322
3-benzyl-N-[(4-chlorophenyl)methyl]-6-hydroxy-N-methyl-1H-indazole-5-carboxamide (PubChem CID 137630322) has the molecular formula C23H20ClN3O2 and a molecular weight of 405.90 g/mol. Its IUPAC name is 3-benzyl-N-[(4-chlorophenyl)methyl]-6-hydroxy-N-methyl-1H-indazole-5-carboxamide.
| Compound Name | 3-benzyl-N-[(4-chlorophenyl)methyl]-6-hydroxy-N-methyl-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 137630322 |
| Molecular Formula | C23H20ClN3O2 |
| Molecular Weight | 405.90 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 3-benzyl-N-[(4-chlorophenyl)methyl]-6-hydroxy-N-methyl-1H-indazole-5-carboxamide |
| SMILES | CN(CC1=CC=C(C=C1)Cl)C(=O)C2=C(C=C3C(=C2)C(=NN3)CC4=CC=CC=C4)O |
| InChI | InChI=1S/C23H20ClN3O2/c1-27(14-16-7-9-17(24)10-8-16)23(29)19-12-18-20(11-15-5-3-2-4-6-15)25-26-21(18)13-22(19)28/h2-10,12-13,28H,11,14H2,1H3,(H,25,26) |
| InChIKey | CPMQCYVAAOTGPW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | 548 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.90 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |