C31H50O4Si — CID 137632706
[(1R,2E,4S,6E,9E,11R)-11-hydroxy-4,11-dimethyl-4-(4-methylpent-3-enyl)-8-oxo-7-(triethylsilylmethyl)cycloundeca-2,6,9-trien-1-yl] 3-methylbut-2-enoate (PubChem CID 137632706) has the molecular formula C31H50O4Si and a molecular weight of 514.80 g/mol. Its IUPAC name is [(1R,2E,4S,6E,9E,11R)-11-hydroxy-4,11-dimethyl-4-(4-methylpent-3-enyl)-8-oxo-7-(triethylsilylmethyl)cycloundeca-2,6,9-trien-1-yl] 3-methylbut-2-enoate.
| Compound Name | [(1R,2E,4S,6E,9E,11R)-11-hydroxy-4,11-dimethyl-4-(4-methylpent-3-enyl)-8-oxo-7-(triethylsilylmethyl)cycloundeca-2,6,9-trien-1-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 137632706 |
| Molecular Formula | C31H50O4Si |
| Molecular Weight | 514.80 g/mol |
| Exact Mass | 514.35 |
| IUPAC Name | [(1R,2E,4S,6E,9E,11R)-11-hydroxy-4,11-dimethyl-4-(4-methylpent-3-enyl)-8-oxo-7-(triethylsilylmethyl)cycloundeca-2,6,9-trien-1-yl] 3-methylbut-2-enoate |
| SMILES | CC[Si](CC)(CC)C/C/1=C/C[C@](/C=C/[C@H]([C@](/C=C/C1=O)(C)O)OC(=O)C=C(C)C)(C)CCC=C(C)C |
| InChI | InChI=1S/C31H50O4Si/c1-10-36(11-2,12-3)23-26-15-19-30(8,18-13-14-24(4)5)20-17-28(35-29(33)22-25(6)7)31(9,34)21-16-27(26)32/h14-17,20-22,28,34H,10-13,18-19,23H2,1-9H3/b20-17+,21-16+,26-15-/t28-,30+,31-/m1/s1 |
| InChIKey | USLHHYNFYOIGEJ-VPZADFMBSA-N |
| XLogP | — |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | 903 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|