C36H33N5O4 — CID 137638936
(2R,3R,4S,5R)-2-[6-(benzylamino)purin-9-yl]-5-(trityloxymethyl)oxolane-3,4-diol (PubChem CID 137638936) has the molecular formula C36H33N5O4 and a molecular weight of 599.70 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-(benzylamino)purin-9-yl]-5-(trityloxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-(benzylamino)purin-9-yl]-5-(trityloxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 137638936 |
| Molecular Formula | C36H33N5O4 |
| Molecular Weight | 599.70 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-(benzylamino)purin-9-yl]-5-(trityloxymethyl)oxolane-3,4-diol |
| SMILES | C1=CC=C(C=C1)CNC2=C3C(=NC=N2)N(C=N3)[C@H]4[C@@H]([C@@H]([C@H](O4)COC(C5=CC=CC=C5)(C6=CC=CC=C6)C7=CC=CC=C7)O)O |
| InChI | InChI=1S/C36H33N5O4/c42-31-29(22-44-36(26-15-7-2-8-16-26,27-17-9-3-10-18-27)28-19-11-4-12-20-28)45-35(32(31)43)41-24-40-30-33(38-23-39-34(30)41)37-21-25-13-5-1-6-14-25/h1-20,23-24,29,31-32,35,42-43H,21-22H2,(H,37,38,39)/t29-,31-,32-,35-/m1/s1 |
| InChIKey | RGOOAICYBVOGEI-QSYCCZFCSA-N |
| XLogP | 4.90 |
| TPSA | 115.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | 858 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.70 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|