C21H22N4O3 — CID 137644677
13-Ethyl-8-(4-methylphenyl)-5-prop-2-enyl-2,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3(7)-diene-6,10,12-trione (PubChem CID 137644677) has the molecular formula C21H22N4O3 and a molecular weight of 378.40 g/mol. Its IUPAC name is 13-ethyl-8-(4-methylphenyl)-5-prop-2-enyl-2,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3(7)-diene-6,10,12-trione.
| Compound Name | 13-Ethyl-8-(4-methylphenyl)-5-prop-2-enyl-2,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3(7)-diene-6,10,12-trione |
|---|---|
| PubChem CID | 137644677 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 13-ethyl-8-(4-methylphenyl)-5-prop-2-enyl-2,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3(7)-diene-6,10,12-trione |
| SMILES | CCN1C2=C(C(C3=C(N2)CN(C3=O)CC=C)C4=CC=C(C=C4)C)C(=O)NC1=O |
| InChI | InChI=1S/C21H22N4O3/c1-4-10-24-11-14-16(20(24)27)15(13-8-6-12(3)7-9-13)17-18(22-14)25(5-2)21(28)23-19(17)26/h4,6-9,15,22H,1,5,10-11H2,2-3H3,(H,23,26,28) |
| InChIKey | SGYUNIXZZZQROD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 81.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | 804 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|