C19H23BrN2O — CID 1376470
4-bromo-2-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]phenol (PubChem CID 1376470) has the molecular formula C19H23BrN2O and a molecular weight of 375.31 g/mol. Its IUPAC name is 4-bromo-2-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]phenol.
| Compound Name | 4-bromo-2-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 1376470 |
| Molecular Formula | C19H23BrN2O |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 4-bromo-2-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]phenol |
| SMILES | Cc1cccc(N2CCN(Cc3cc(Br)ccc3O)CC2)c1C |
| InChI | InChI=1S/C19H23BrN2O/c1-14-4-3-5-18(15(14)2)22-10-8-21(9-11-22)13-16-12-17(20)6-7-19(16)23/h3-7,12,23H,8-11,13H2,1-2H3 |
| InChIKey | ZQPDRSZLRAKKNO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|