About 1-(2,5-dimethylphenyl)-4-[(2-methylphenyl)methyl]piperazine
1-(2,5-dimethylphenyl)-4-[(2-methylphenyl)methyl]piperazine (PubChem CID 1376508) has the molecular formula C20H26N2
and a molecular weight of 294.44 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-4-[(2-methylphenyl)methyl]piperazine.
Molecular Properties
| Compound Name | 1-(2,5-dimethylphenyl)-4-[(2-methylphenyl)methyl]piperazine |
| PubChem CID | 1376508 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-4-[(2-methylphenyl)methyl]piperazine |
| SMILES | Cc1ccc(C)c(N2CCN(Cc3ccccc3C)CC2)c1 |
| InChI | InChI=1S/C20H26N2/c1-16-8-9-18(3)20(14-16)22-12-10-21(11-13-22)15-19-7-5-4-6-17(19)2/h4-9,14H,10-13,15H2,1-3H3 |
| InChIKey | PDOGPIRDBACISK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,5-dimethylphenyl)-4-[(2-methylphenyl)methyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dimethylphenyl)-4-[(2-methylphenyl)methyl]piperazine?
The IUPAC name of 1-(2,5-dimethylphenyl)-4-[(2-methylphenyl)methyl]piperazine (CID 1376508) is 1-(2,5-dimethylphenyl)-4-[(2-methylphenyl)methyl]piperazine.
What is the SMILES notation for 1-(2,5-dimethylphenyl)-4-[(2-methylphenyl)methyl]piperazine?
The canonical SMILES for 1-(2,5-dimethylphenyl)-4-[(2-methylphenyl)methyl]piperazine is Cc1ccc(C)c(N2CCN(Cc3ccccc3C)CC2)c1.
What is the InChIKey of 1-(2,5-dimethylphenyl)-4-[(2-methylphenyl)methyl]piperazine?
The InChIKey is PDOGPIRDBACISK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N2/c1-16-8-9-18(3)20(14-16)22-12-10-21(11-13-22)15-19-7-5-4-6-17(19)2/h4-9,14H,10-13,15H2,1-3H3.
What are the key properties of 1-(2,5-dimethylphenyl)-4-[(2-methylphenyl)methyl]piperazine?
1-(2,5-dimethylphenyl)-4-[(2-methylphenyl)methyl]piperazine has a molecular weight of 294.44 g/mol, XLogP of 3.93, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dimethylphenyl)-4-[(2-methylphenyl)methyl]piperazine is sourced from PubChem (CID 1376508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).