C9H6BrCl3N2O2 — CID 1376669
N-[(4-bromophenyl)carbamoyl]-2,2,2-trichloroacetamide (PubChem CID 1376669) has the molecular formula C9H6BrCl3N2O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is N-[(4-bromophenyl)carbamoyl]-2,2,2-trichloroacetamide.
| Compound Name | N-[(4-bromophenyl)carbamoyl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 1376669 |
| Molecular Formula | C9H6BrCl3N2O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 357.87 |
| IUPAC Name | N-[(4-bromophenyl)carbamoyl]-2,2,2-trichloroacetamide |
| SMILES | O=C(NC(=O)C(Cl)(Cl)Cl)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C9H6BrCl3N2O2/c10-5-1-3-6(4-2-5)14-8(17)15-7(16)9(11,12)13/h1-4H,(H2,14,15,16,17) |
| InChIKey | UGJNCGYWWKSSMB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|