C11H6Cl3F3N4O — CID 1376680
4,6-dichloro-N-[2-[(2R)-2-chloro-1,1,2-trifluoroethoxy]phenyl]-1,3,5-triazin-2-amine (PubChem CID 1376680) has the molecular formula C11H6Cl3F3N4O and a molecular weight of 373.55 g/mol. Its IUPAC name is 4,6-dichloro-N-[2-[(2R)-2-chloro-1,1,2-trifluoroethoxy]phenyl]-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dichloro-N-[2-[(2R)-2-chloro-1,1,2-trifluoroethoxy]phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 1376680 |
| Molecular Formula | C11H6Cl3F3N4O |
| Molecular Weight | 373.55 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | 4,6-dichloro-N-[2-[(2R)-2-chloro-1,1,2-trifluoroethoxy]phenyl]-1,3,5-triazin-2-amine |
| SMILES | F[C@H](Cl)C(F)(F)Oc1ccccc1Nc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C11H6Cl3F3N4O/c12-7(15)11(16,17)22-6-4-2-1-3-5(6)18-10-20-8(13)19-9(14)21-10/h1-4,7H,(H,18,19,20,21)/t7-/m0/s1 |
| InChIKey | VOPXUXFNEQEFEG-ZETCQYMHSA-N |
| XLogP | 4.43 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|