C13H14ClN5O4S — CID 1376682
1-(2-chlorophenyl)sulfonyl-3-(4-ethoxy-6-methyl-1,3,5-triazin-2-yl)urea (PubChem CID 1376682) has the molecular formula C13H14ClN5O4S and a molecular weight of 371.81 g/mol. Its IUPAC name is 1-(2-chlorophenyl)sulfonyl-3-(4-ethoxy-6-methyl-1,3,5-triazin-2-yl)urea.
| Compound Name | 1-(2-chlorophenyl)sulfonyl-3-(4-ethoxy-6-methyl-1,3,5-triazin-2-yl)urea |
|---|---|
| PubChem CID | 1376682 |
| Molecular Formula | C13H14ClN5O4S |
| Molecular Weight | 371.81 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 1-(2-chlorophenyl)sulfonyl-3-(4-ethoxy-6-methyl-1,3,5-triazin-2-yl)urea |
| SMILES | CCOc1nc(C)nc(NC(=O)NS(=O)(=O)c2ccccc2Cl)n1 |
| InChI | InChI=1S/C13H14ClN5O4S/c1-3-23-13-16-8(2)15-11(18-13)17-12(20)19-24(21,22)10-7-5-4-6-9(10)14/h4-7H,3H2,1-2H3,(H2,15,16,17,18,19,20) |
| InChIKey | YHVRQPXORKMKEG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 123.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.81 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |