C15H20N4O4 — CID 1376763
(1R,11S,15R)-11-morpholin-4-yl-10-oxido-4-oxa-3,5-diaza-10-azoniatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-1-ol (PubChem CID 1376763) has the molecular formula C15H20N4O4 and a molecular weight of 320.35 g/mol. Its IUPAC name is (1R,11S,15R)-11-morpholin-4-yl-10-oxido-4-oxa-3,5-diaza-10-azoniatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-1-ol.
| Compound Name | (1R,11S,15R)-11-morpholin-4-yl-10-oxido-4-oxa-3,5-diaza-10-azoniatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-1-ol |
|---|---|
| PubChem CID | 1376763 |
| Molecular Formula | C15H20N4O4 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | (1R,11S,15R)-11-morpholin-4-yl-10-oxido-4-oxa-3,5-diaza-10-azoniatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-1-ol |
| SMILES | [O-][N+]1=C2CCc3nonc3[C@]2(O)[C@@H]2CCC[C@@]21N1CCOCC1 |
| InChI | InChI=1S/C15H20N4O4/c20-15-11-2-1-5-14(11,18-6-8-22-9-7-18)19(21)12(15)4-3-10-13(15)17-23-16-10/h11,20H,1-9H2/t11-,14+,15+/m1/s1 |
| InChIKey | HMPOXIXECQTLTG-UGFHNGPFSA-N |
| XLogP | -0.00 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|