C21H28N2O3 — CID 1377098
1-[(2,3-dimethoxyphenyl)methyl]-4-(2-ethoxyphenyl)piperazine (PubChem CID 1377098) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-[(2,3-dimethoxyphenyl)methyl]-4-(2-ethoxyphenyl)piperazine.
| Compound Name | 1-[(2,3-dimethoxyphenyl)methyl]-4-(2-ethoxyphenyl)piperazine |
|---|---|
| PubChem CID | 1377098 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 1-[(2,3-dimethoxyphenyl)methyl]-4-(2-ethoxyphenyl)piperazine |
| SMILES | CCOc1ccccc1N1CCN(Cc2cccc(OC)c2OC)CC1 |
| InChI | InChI=1S/C21H28N2O3/c1-4-26-19-10-6-5-9-18(19)23-14-12-22(13-15-23)16-17-8-7-11-20(24-2)21(17)25-3/h5-11H,4,12-16H2,1-3H3 |
| InChIKey | VSBTYOLMXRIGMY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |