About 1-[(4-methoxy-2,5-dimethylphenyl)methyl]-4-phenylpiperazine
1-[(4-methoxy-2,5-dimethylphenyl)methyl]-4-phenylpiperazine (PubChem CID 1377111) has the molecular formula C20H26N2O
and a molecular weight of 310.44 g/mol. Its IUPAC name is 1-[(4-methoxy-2,5-dimethylphenyl)methyl]-4-phenylpiperazine.
Molecular Properties
| Compound Name | 1-[(4-methoxy-2,5-dimethylphenyl)methyl]-4-phenylpiperazine |
| PubChem CID | 1377111 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 1-[(4-methoxy-2,5-dimethylphenyl)methyl]-4-phenylpiperazine |
| SMILES | COc1cc(C)c(CN2CCN(c3ccccc3)CC2)cc1C |
| InChI | InChI=1S/C20H26N2O/c1-16-14-20(23-3)17(2)13-18(16)15-21-9-11-22(12-10-21)19-7-5-4-6-8-19/h4-8,13-14H,9-12,15H2,1-3H3 |
| InChIKey | NFGJGJHFBGZVMK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(4-methoxy-2,5-dimethylphenyl)methyl]-4-phenylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-methoxy-2,5-dimethylphenyl)methyl]-4-phenylpiperazine?
The IUPAC name of 1-[(4-methoxy-2,5-dimethylphenyl)methyl]-4-phenylpiperazine (CID 1377111) is 1-[(4-methoxy-2,5-dimethylphenyl)methyl]-4-phenylpiperazine.
What is the SMILES notation for 1-[(4-methoxy-2,5-dimethylphenyl)methyl]-4-phenylpiperazine?
The canonical SMILES for 1-[(4-methoxy-2,5-dimethylphenyl)methyl]-4-phenylpiperazine is COc1cc(C)c(CN2CCN(c3ccccc3)CC2)cc1C.
What is the InChIKey of 1-[(4-methoxy-2,5-dimethylphenyl)methyl]-4-phenylpiperazine?
The InChIKey is NFGJGJHFBGZVMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N2O/c1-16-14-20(23-3)17(2)13-18(16)15-21-9-11-22(12-10-21)19-7-5-4-6-8-19/h4-8,13-14H,9-12,15H2,1-3H3.
What are the key properties of 1-[(4-methoxy-2,5-dimethylphenyl)methyl]-4-phenylpiperazine?
1-[(4-methoxy-2,5-dimethylphenyl)methyl]-4-phenylpiperazine has a molecular weight of 310.44 g/mol, XLogP of 3.63, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-methoxy-2,5-dimethylphenyl)methyl]-4-phenylpiperazine is sourced from PubChem (CID 1377111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).