About 4-benzyl-1-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperidine
4-benzyl-1-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperidine (PubChem CID 1377125) has the molecular formula C21H26N2O4
and a molecular weight of 370.45 g/mol. Its IUPAC name is 4-benzyl-1-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperidine.
Molecular Properties
| Compound Name | 4-benzyl-1-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperidine |
| PubChem CID | 1377125 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 4-benzyl-1-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperidine |
| SMILES | COc1cc(CN2CCC(Cc3ccccc3)CC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C21H26N2O4/c1-26-20-13-18(19(23(24)25)14-21(20)27-2)15-22-10-8-17(9-11-22)12-16-6-4-3-5-7-16/h3-7,13-14,17H,8-12,15H2,1-2H3 |
| InChIKey | VERRLRRGCGPLBB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-benzyl-1-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-1-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperidine?
The IUPAC name of 4-benzyl-1-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperidine (CID 1377125) is 4-benzyl-1-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperidine.
What is the SMILES notation for 4-benzyl-1-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperidine?
The canonical SMILES for 4-benzyl-1-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperidine is COc1cc(CN2CCC(Cc3ccccc3)CC2)c([N+](=O)[O-])cc1OC.
What is the InChIKey of 4-benzyl-1-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperidine?
The InChIKey is VERRLRRGCGPLBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O4/c1-26-20-13-18(19(23(24)25)14-21(20)27-2)15-22-10-8-17(9-11-22)12-16-6-4-3-5-7-16/h3-7,13-14,17H,8-12,15H2,1-2H3.
What are the key properties of 4-benzyl-1-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperidine?
4-benzyl-1-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperidine has a molecular weight of 370.45 g/mol, XLogP of 4.07, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-1-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperidine is sourced from PubChem (CID 1377125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).