About 1-[(2,3-dimethoxyphenyl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine
1-[(2,3-dimethoxyphenyl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine (PubChem CID 1377324) has the molecular formula C20H23F3N2O2
and a molecular weight of 380.41 g/mol. Its IUPAC name is 1-[(2,3-dimethoxyphenyl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine.
Molecular Properties
| Compound Name | 1-[(2,3-dimethoxyphenyl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine |
| PubChem CID | 1377324 |
| Molecular Formula | C20H23F3N2O2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 1-[(2,3-dimethoxyphenyl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine |
| SMILES | COc1cccc(CN2CCN(c3cccc(C(F)(F)F)c3)CC2)c1OC |
| InChI | InChI=1S/C20H23F3N2O2/c1-26-18-8-3-5-15(19(18)27-2)14-24-9-11-25(12-10-24)17-7-4-6-16(13-17)20(21,22)23/h3-8,13H,9-12,14H2,1-2H3 |
| InChIKey | BAIRDSZZLQZRND-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(2,3-dimethoxyphenyl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,3-dimethoxyphenyl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine?
The IUPAC name of 1-[(2,3-dimethoxyphenyl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine (CID 1377324) is 1-[(2,3-dimethoxyphenyl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine.
What is the SMILES notation for 1-[(2,3-dimethoxyphenyl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine?
The canonical SMILES for 1-[(2,3-dimethoxyphenyl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine is COc1cccc(CN2CCN(c3cccc(C(F)(F)F)c3)CC2)c1OC.
What is the InChIKey of 1-[(2,3-dimethoxyphenyl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine?
The InChIKey is BAIRDSZZLQZRND-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23F3N2O2/c1-26-18-8-3-5-15(19(18)27-2)14-24-9-11-25(12-10-24)17-7-4-6-16(13-17)20(21,22)23/h3-8,13H,9-12,14H2,1-2H3.
What are the key properties of 1-[(2,3-dimethoxyphenyl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine?
1-[(2,3-dimethoxyphenyl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine has a molecular weight of 380.41 g/mol, XLogP of 4.04, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,3-dimethoxyphenyl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine is sourced from PubChem (CID 1377324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).