About 1-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-bromo-4-methylphenyl)methanimine
1-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-bromo-4-methylphenyl)methanimine (PubChem CID 1377883) has the molecular formula C15H11Br2NO2
and a molecular weight of 397.07 g/mol. Its IUPAC name is 1-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-bromo-4-methylphenyl)methanimine.
Molecular Properties
| Compound Name | 1-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-bromo-4-methylphenyl)methanimine |
| PubChem CID | 1377883 |
| Molecular Formula | C15H11Br2NO2 |
| Molecular Weight | 397.07 g/mol |
| Exact Mass | 394.92 |
| IUPAC Name | 1-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-bromo-4-methylphenyl)methanimine |
| SMILES | Cc1ccc(/N=C/c2cc3c(cc2Br)OCO3)c(Br)c1 |
| InChI | InChI=1S/C15H11Br2NO2/c1-9-2-3-13(12(17)4-9)18-7-10-5-14-15(6-11(10)16)20-8-19-14/h2-7H,8H2,1H3/b18-7+ |
| InChIKey | FACLMNASHGVYRW-CNHKJKLMSA-N |
| XLogP | 5.00 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.07 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-bromo-4-methylphenyl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-bromo-4-methylphenyl)methanimine?
The IUPAC name of 1-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-bromo-4-methylphenyl)methanimine (CID 1377883) is 1-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-bromo-4-methylphenyl)methanimine.
What is the SMILES notation for 1-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-bromo-4-methylphenyl)methanimine?
The canonical SMILES for 1-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-bromo-4-methylphenyl)methanimine is Cc1ccc(/N=C/c2cc3c(cc2Br)OCO3)c(Br)c1.
What is the InChIKey of 1-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-bromo-4-methylphenyl)methanimine?
The InChIKey is FACLMNASHGVYRW-CNHKJKLMSA-N. The full InChI is InChI=1S/C15H11Br2NO2/c1-9-2-3-13(12(17)4-9)18-7-10-5-14-15(6-11(10)16)20-8-19-14/h2-7H,8H2,1H3/b18-7+.
What are the key properties of 1-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-bromo-4-methylphenyl)methanimine?
1-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-bromo-4-methylphenyl)methanimine has a molecular weight of 397.07 g/mol, XLogP of 5.00, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-bromo-1,3-benzodioxol-5-yl)-N-(2-bromo-4-methylphenyl)methanimine is sourced from PubChem (CID 1377883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).