C19H17N3O2S — CID 1377905
6-ethyl-16-methoxy-5-thia-3,10,20-triazapentacyclo[11.7.0.02,10.04,8.014,19]icosa-1(13),2,4(8),6,14(19),15,17-heptaen-9-one (PubChem CID 1377905) has the molecular formula C19H17N3O2S and a molecular weight of 351.43 g/mol. Its IUPAC name is 6-ethyl-16-methoxy-5-thia-3,10,20-triazapentacyclo[11.7.0.02,10.04,8.014,19]icosa-1(13),2,4(8),6,14(19),15,17-heptaen-9-one.
| Compound Name | 6-ethyl-16-methoxy-5-thia-3,10,20-triazapentacyclo[11.7.0.02,10.04,8.014,19]icosa-1(13),2,4(8),6,14(19),15,17-heptaen-9-one |
|---|---|
| PubChem CID | 1377905 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 6-ethyl-16-methoxy-5-thia-3,10,20-triazapentacyclo[11.7.0.02,10.04,8.014,19]icosa-1(13),2,4(8),6,14(19),15,17-heptaen-9-one |
| SMILES | CCc1cc2c(=O)n3c(nc2s1)-c1[nH]c2ccc(OC)cc2c1CC3 |
| InChI | InChI=1S/C19H17N3O2S/c1-3-11-9-14-18(25-11)21-17-16-12(6-7-22(17)19(14)23)13-8-10(24-2)4-5-15(13)20-16/h4-5,8-9,20H,3,6-7H2,1-2H3 |
| InChIKey | WHWPYHHVMOJZSV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|