About [(5S,7R)-3-(4-methylphenyl)-1-adamantyl]methanamine
[(5S,7R)-3-(4-methylphenyl)-1-adamantyl]methanamine (PubChem CID 1377968) has the molecular formula C18H25N
and a molecular weight of 255.40 g/mol. Its IUPAC name is [(5S,7R)-3-(4-methylphenyl)-1-adamantyl]methanamine.
Molecular Properties
| Compound Name | [(5S,7R)-3-(4-methylphenyl)-1-adamantyl]methanamine |
| PubChem CID | 1377968 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | [(5S,7R)-3-(4-methylphenyl)-1-adamantyl]methanamine |
| SMILES | Cc1ccc(C23C[C@@H]4C[C@@H](CC(CN)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C18H25N/c1-13-2-4-16(5-3-13)18-9-14-6-15(10-18)8-17(7-14,11-18)12-19/h2-5,14-15H,6-12,19H2,1H3/t14-,15+,17?,18? |
| InChIKey | DSNJWBWIHZBKBY-BXXOZEPKSA-N |
| XLogP | 3.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(5S,7R)-3-(4-methylphenyl)-1-adamantyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5S,7R)-3-(4-methylphenyl)-1-adamantyl]methanamine?
The IUPAC name of [(5S,7R)-3-(4-methylphenyl)-1-adamantyl]methanamine (CID 1377968) is [(5S,7R)-3-(4-methylphenyl)-1-adamantyl]methanamine.
What is the SMILES notation for [(5S,7R)-3-(4-methylphenyl)-1-adamantyl]methanamine?
The canonical SMILES for [(5S,7R)-3-(4-methylphenyl)-1-adamantyl]methanamine is Cc1ccc(C23C[C@@H]4C[C@@H](CC(CN)(C4)C2)C3)cc1.
What is the InChIKey of [(5S,7R)-3-(4-methylphenyl)-1-adamantyl]methanamine?
The InChIKey is DSNJWBWIHZBKBY-BXXOZEPKSA-N. The full InChI is InChI=1S/C18H25N/c1-13-2-4-16(5-3-13)18-9-14-6-15(10-18)8-17(7-14,11-18)12-19/h2-5,14-15H,6-12,19H2,1H3/t14-,15+,17?,18?.
What are the key properties of [(5S,7R)-3-(4-methylphenyl)-1-adamantyl]methanamine?
[(5S,7R)-3-(4-methylphenyl)-1-adamantyl]methanamine has a molecular weight of 255.40 g/mol, XLogP of 3.79, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(5S,7R)-3-(4-methylphenyl)-1-adamantyl]methanamine is sourced from PubChem (CID 1377968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).