C14H21N5O6S — CID 13781
2-amino-1-methyl-1,5-dihydroimidazol-1-ium-4-one;2-(5-hydroxy-1H-indol-3-yl)ethylazanium;sulfate (PubChem CID 13781) has the molecular formula C14H21N5O6S and a molecular weight of 387.42 g/mol. Its IUPAC name is 2-amino-1-methyl-1,5-dihydroimidazol-1-ium-4-one;2-(5-hydroxy-1H-indol-3-yl)ethylazanium;sulfate.
| Compound Name | 2-amino-1-methyl-1,5-dihydroimidazol-1-ium-4-one;2-(5-hydroxy-1H-indol-3-yl)ethylazanium;sulfate |
|---|---|
| PubChem CID | 13781 |
| Molecular Formula | C14H21N5O6S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 2-amino-1-methyl-1,5-dihydroimidazol-1-ium-4-one;2-(5-hydroxy-1H-indol-3-yl)ethylazanium;sulfate |
| SMILES | C[NH+]1CC(=O)N=C1N.O=S(=O)([O-])[O-].[NH3+]CCc1c[nH]c2ccc(O)cc12 |
| InChI | InChI=1S/C10H12N2O.C4H7N3O.H2O4S/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10;1-7-2-3(8)6-4(7)5;1-5(2,3)4/h1-2,5-6,12-13H,3-4,11H2;2H2,1H3,(H2,5,6,8);(H2,1,2,3,4) |
| InChIKey | WFZKRNIMSVDNBU-UHFFFAOYSA-N |
| XLogP | -3.32 |
| TPSA | 203.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | -3.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|