About 4-[[2-(3,4-dimethoxyphenyl)ethyl-methylamino]methyl]-N,N-diethylaniline
4-[[2-(3,4-dimethoxyphenyl)ethyl-methylamino]methyl]-N,N-diethylaniline (PubChem CID 1378271) has the molecular formula C22H32N2O2
and a molecular weight of 356.51 g/mol. Its IUPAC name is 4-[[2-(3,4-dimethoxyphenyl)ethyl-methylamino]methyl]-N,N-diethylaniline.
Molecular Properties
| Compound Name | 4-[[2-(3,4-dimethoxyphenyl)ethyl-methylamino]methyl]-N,N-diethylaniline |
| PubChem CID | 1378271 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | 4-[[2-(3,4-dimethoxyphenyl)ethyl-methylamino]methyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(CN(C)CCc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C22H32N2O2/c1-6-24(7-2)20-11-8-19(9-12-20)17-23(3)15-14-18-10-13-21(25-4)22(16-18)26-5/h8-13,16H,6-7,14-15,17H2,1-5H3 |
| InChIKey | ITNUOBZVVCQYIR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 4-[[2-(3,4-dimethoxyphenyl)ethyl-methylamino]methyl]-N,N-diethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-(3,4-dimethoxyphenyl)ethyl-methylamino]methyl]-N,N-diethylaniline?
The IUPAC name of 4-[[2-(3,4-dimethoxyphenyl)ethyl-methylamino]methyl]-N,N-diethylaniline (CID 1378271) is 4-[[2-(3,4-dimethoxyphenyl)ethyl-methylamino]methyl]-N,N-diethylaniline.
What is the SMILES notation for 4-[[2-(3,4-dimethoxyphenyl)ethyl-methylamino]methyl]-N,N-diethylaniline?
The canonical SMILES for 4-[[2-(3,4-dimethoxyphenyl)ethyl-methylamino]methyl]-N,N-diethylaniline is CCN(CC)c1ccc(CN(C)CCc2ccc(OC)c(OC)c2)cc1.
What is the InChIKey of 4-[[2-(3,4-dimethoxyphenyl)ethyl-methylamino]methyl]-N,N-diethylaniline?
The InChIKey is ITNUOBZVVCQYIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32N2O2/c1-6-24(7-2)20-11-8-19(9-12-20)17-23(3)15-14-18-10-13-21(25-4)22(16-18)26-5/h8-13,16H,6-7,14-15,17H2,1-5H3.
What are the key properties of 4-[[2-(3,4-dimethoxyphenyl)ethyl-methylamino]methyl]-N,N-diethylaniline?
4-[[2-(3,4-dimethoxyphenyl)ethyl-methylamino]methyl]-N,N-diethylaniline has a molecular weight of 356.51 g/mol, XLogP of 4.22, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(3,4-dimethoxyphenyl)ethyl-methylamino]methyl]-N,N-diethylaniline is sourced from PubChem (CID 1378271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).