C13H18Br2N2O — CID 1378307
2,4-dibromo-6-[(4-ethylpiperazin-1-yl)methyl]phenol (PubChem CID 1378307) has the molecular formula C13H18Br2N2O and a molecular weight of 378.11 g/mol. Its IUPAC name is 2,4-dibromo-6-[(4-ethylpiperazin-1-yl)methyl]phenol.
| Compound Name | 2,4-dibromo-6-[(4-ethylpiperazin-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 1378307 |
| Molecular Formula | C13H18Br2N2O |
| Molecular Weight | 378.11 g/mol |
| Exact Mass | 375.98 |
| IUPAC Name | 2,4-dibromo-6-[(4-ethylpiperazin-1-yl)methyl]phenol |
| SMILES | CCN1CCN(Cc2cc(Br)cc(Br)c2O)CC1 |
| InChI | InChI=1S/C13H18Br2N2O/c1-2-16-3-5-17(6-4-16)9-10-7-11(14)8-12(15)13(10)18/h7-8,18H,2-6,9H2,1H3 |
| InChIKey | WZCBGCQORJMSOR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.11 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|