C25H29NO — CID 1378355
N-[(2R)-1-(4-methoxyphenyl)propan-2-yl]-3,3-diphenylpropan-1-amine (PubChem CID 1378355) has the molecular formula C25H29NO and a molecular weight of 359.51 g/mol. Its IUPAC name is N-[(2R)-1-(4-methoxyphenyl)propan-2-yl]-3,3-diphenylpropan-1-amine.
| Compound Name | N-[(2R)-1-(4-methoxyphenyl)propan-2-yl]-3,3-diphenylpropan-1-amine |
|---|---|
| PubChem CID | 1378355 |
| Molecular Formula | C25H29NO |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | N-[(2R)-1-(4-methoxyphenyl)propan-2-yl]-3,3-diphenylpropan-1-amine |
| SMILES | COc1ccc(C[C@@H](C)NCCC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H29NO/c1-20(19-21-13-15-24(27-2)16-14-21)26-18-17-25(22-9-5-3-6-10-22)23-11-7-4-8-12-23/h3-16,20,25-26H,17-19H2,1-2H3/t20-/m1/s1 |
| InChIKey | JBDNRLFNOXESPO-HXUWFJFHSA-N |
| XLogP | 5.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |