C22H41N3O2 — CID 1378486
(2,2,6,6-tetramethylpiperidin-4-yl) 3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]but-2-enoate (PubChem CID 1378486) has the molecular formula C22H41N3O2 and a molecular weight of 379.59 g/mol. Its IUPAC name is (2,2,6,6-tetramethylpiperidin-4-yl) 3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]but-2-enoate.
| Compound Name | (2,2,6,6-tetramethylpiperidin-4-yl) 3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]but-2-enoate |
|---|---|
| PubChem CID | 1378486 |
| Molecular Formula | C22H41N3O2 |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 379.32 |
| IUPAC Name | (2,2,6,6-tetramethylpiperidin-4-yl) 3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]but-2-enoate |
| SMILES | CC(=CC(=O)OC1CC(C)(C)NC(C)(C)C1)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C22H41N3O2/c1-15(23-16-11-19(2,3)24-20(4,5)12-16)10-18(26)27-17-13-21(6,7)25-22(8,9)14-17/h10,16-17,23-25H,11-14H2,1-9H3 |
| InChIKey | BHBSBLITCCGYLJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|