C9H13NO2 — CID 13785796
1-(2-Hydroxyethyl)-4,6-dimethylpyridin-2(1H)-one (PubChem CID 13785796) has the molecular formula C9H13NO2 and a molecular weight of 167.20 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-4,6-dimethylpyridin-2-one.
| Compound Name | 1-(2-Hydroxyethyl)-4,6-dimethylpyridin-2(1H)-one |
|---|---|
| PubChem CID | 13785796 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.20 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 1-(2-hydroxyethyl)-4,6-dimethylpyridin-2-one |
| SMILES | CC1=CC(=O)N(C(=C1)C)CCO |
| InChI | InChI=1S/C9H13NO2/c1-7-5-8(2)10(3-4-11)9(12)6-7/h5-6,11H,3-4H2,1-2H3 |
| InChIKey | CYJQPEJYDZJTGY-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 40.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | 253 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.20 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |