C18H31NO2 — CID 1378757
1-[[(2R,4S)-2-[(1S,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]-1,3-dioxolan-4-yl]methyl]piperidine (PubChem CID 1378757) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is 1-[[(2R,4S)-2-[(1S,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]-1,3-dioxolan-4-yl]methyl]piperidine.
| Compound Name | 1-[[(2R,4S)-2-[(1S,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]-1,3-dioxolan-4-yl]methyl]piperidine |
|---|---|
| PubChem CID | 1378757 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | 1-[[(2R,4S)-2-[(1S,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]-1,3-dioxolan-4-yl]methyl]piperidine |
| SMILES | CC1=C[C@H](C)[C@@H]([C@@H]2OC[C@H](CN3CCCCC3)O2)[C@H](C)C1 |
| InChI | InChI=1S/C18H31NO2/c1-13-9-14(2)17(15(3)10-13)18-20-12-16(21-18)11-19-7-5-4-6-8-19/h9,14-18H,4-8,10-12H2,1-3H3/t14-,15+,16-,17+,18+/m0/s1 |
| InChIKey | RJXDBTDFBZRPHG-IGKNDFSCSA-N |
| XLogP | 3.45 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|