C8H7N5O4 — CID 1378895
ethyl 6-nitro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 1378895) has the molecular formula C8H7N5O4 and a molecular weight of 237.17 g/mol. Its IUPAC name is ethyl 6-nitro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | ethyl 6-nitro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 1378895 |
| Molecular Formula | C8H7N5O4 |
| Molecular Weight | 237.17 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | ethyl 6-nitro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | CCOC(=O)c1nc2ncc([N+](=O)[O-])cn2n1 |
| InChI | InChI=1S/C8H7N5O4/c1-2-17-7(14)6-10-8-9-3-5(13(15)16)4-12(8)11-6/h3-4H,2H2,1H3 |
| InChIKey | IFAAKHLFOBVSRR-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 112.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.17 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|