C23H28O2 — CID 1378996
(3R,3aR,3bR,11aS,11bS)-3-methyl-3-phenyl-3a,3b,4,5,6,7,8,9,10,11,11a,11b-dodecahydrophenanthro[9,10-c]furan-1-one (PubChem CID 1378996) has the molecular formula C23H28O2 and a molecular weight of 336.47 g/mol. Its IUPAC name is (3R,3aR,3bR,11aS,11bS)-3-methyl-3-phenyl-3a,3b,4,5,6,7,8,9,10,11,11a,11b-dodecahydrophenanthro[9,10-c]furan-1-one.
| Compound Name | (3R,3aR,3bR,11aS,11bS)-3-methyl-3-phenyl-3a,3b,4,5,6,7,8,9,10,11,11a,11b-dodecahydrophenanthro[9,10-c]furan-1-one |
|---|---|
| PubChem CID | 1378996 |
| Molecular Formula | C23H28O2 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | (3R,3aR,3bR,11aS,11bS)-3-methyl-3-phenyl-3a,3b,4,5,6,7,8,9,10,11,11a,11b-dodecahydrophenanthro[9,10-c]furan-1-one |
| SMILES | C[C@@]1(c2ccccc2)OC(=O)[C@@H]2[C@H]1[C@H]1CCCCC1=C1CCCC[C@H]12 |
| InChI | InChI=1S/C23H28O2/c1-23(15-9-3-2-4-10-15)21-19-14-8-6-12-17(19)16-11-5-7-13-18(16)20(21)22(24)25-23/h2-4,9-10,18-21H,5-8,11-14H2,1H3/t18-,19+,20+,21-,23+/m1/s1 |
| InChIKey | MULDAFDMOJEJEP-MKQKURRLSA-N |
| XLogP | 5.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|