C14H14O — CID 1379022
(1R)-1,2-diphenylethanol (PubChem CID 1379022) has the molecular formula C14H14O and a molecular weight of 198.26 g/mol. Its IUPAC name is (1R)-1,2-diphenylethanol.
| Compound Name | (1R)-1,2-diphenylethanol |
|---|---|
| PubChem CID | 1379022 |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | (1R)-1,2-diphenylethanol |
| SMILES | O[C@H](Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H14O/c15-14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-10,14-15H,11H2/t14-/m1/s1 |
| InChIKey | GBGXVCNOKWAMIP-CQSZACIVSA-N |
| XLogP | 2.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |