C8H8BrF4N3O — CID 1379281
5-bromo-4-methyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-2-amine (PubChem CID 1379281) has the molecular formula C8H8BrF4N3O and a molecular weight of 318.07 g/mol. Its IUPAC name is 5-bromo-4-methyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-2-amine.
| Compound Name | 5-bromo-4-methyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-2-amine |
|---|---|
| PubChem CID | 1379281 |
| Molecular Formula | C8H8BrF4N3O |
| Molecular Weight | 318.07 g/mol |
| Exact Mass | 316.98 |
| IUPAC Name | 5-bromo-4-methyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-2-amine |
| SMILES | Cc1nc(N)nc(OCC(F)(F)C(F)F)c1Br |
| InChI | InChI=1S/C8H8BrF4N3O/c1-3-4(9)5(16-7(14)15-3)17-2-8(12,13)6(10)11/h6H,2H2,1H3,(H2,14,15,16) |
| InChIKey | SDNZUJVGLDNXCM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.07 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|