About 2-Amino-3-(thiolan-3-yl)propanoic acid hydrochloride
2-Amino-3-(thiolan-3-yl)propanoic acid hydrochloride (PubChem CID 137943440) has the molecular formula C7H14ClNO2S
and a molecular weight of 211.71 g/mol. Its IUPAC name is 2-amino-3-(thiolan-3-yl)propanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-Amino-3-(thiolan-3-yl)propanoic acid hydrochloride |
| PubChem CID | 137943440 |
| Molecular Formula | C7H14ClNO2S |
| Molecular Weight | 211.71 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 2-amino-3-(thiolan-3-yl)propanoic acid;hydrochloride |
| SMILES | C1CSCC1CC(C(=O)O)N.Cl |
| InChI | InChI=1S/C7H13NO2S.ClH/c8-6(7(9)10)3-5-1-2-11-4-5;/h5-6H,1-4,8H2,(H,9,10);1H |
| InChIKey | AHZJTGJFXWAMBP-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 88.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | 151 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-Amino-3-(thiolan-3-yl)propanoic acid hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-Amino-3-(thiolan-3-yl)propanoic acid hydrochloride?
The IUPAC name of 2-Amino-3-(thiolan-3-yl)propanoic acid hydrochloride (CID 137943440) is 2-amino-3-(thiolan-3-yl)propanoic acid;hydrochloride.
What is the SMILES notation for 2-Amino-3-(thiolan-3-yl)propanoic acid hydrochloride?
The canonical SMILES for 2-Amino-3-(thiolan-3-yl)propanoic acid hydrochloride is C1CSCC1CC(C(=O)O)N.Cl.
What is the InChIKey of 2-Amino-3-(thiolan-3-yl)propanoic acid hydrochloride?
The InChIKey is AHZJTGJFXWAMBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2S.ClH/c8-6(7(9)10)3-5-1-2-11-4-5;/h5-6H,1-4,8H2,(H,9,10);1H.
What are the key properties of 2-Amino-3-(thiolan-3-yl)propanoic acid hydrochloride?
2-Amino-3-(thiolan-3-yl)propanoic acid hydrochloride has a molecular weight of 211.71 g/mol, XLogP of not available, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-Amino-3-(thiolan-3-yl)propanoic acid hydrochloride is sourced from PubChem (CID 137943440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).