About 1,3-dicyclohexyl-6-hydroxy-5-[(4-methoxyphenyl)iminomethyl]pyrimidine-2,4-dione
1,3-dicyclohexyl-6-hydroxy-5-[(4-methoxyphenyl)iminomethyl]pyrimidine-2,4-dione (PubChem CID 1379444) has the molecular formula C24H31N3O4
and a molecular weight of 425.53 g/mol. Its IUPAC name is 1,3-dicyclohexyl-6-hydroxy-5-[(4-methoxyphenyl)iminomethyl]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1,3-dicyclohexyl-6-hydroxy-5-[(4-methoxyphenyl)iminomethyl]pyrimidine-2,4-dione |
| PubChem CID | 1379444 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 1,3-dicyclohexyl-6-hydroxy-5-[(4-methoxyphenyl)iminomethyl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(/N=C/c2c(O)n(C3CCCCC3)c(=O)n(C3CCCCC3)c2=O)cc1 |
| InChI | InChI=1S/C24H31N3O4/c1-31-20-14-12-17(13-15-20)25-16-21-22(28)26(18-8-4-2-5-9-18)24(30)27(23(21)29)19-10-6-3-7-11-19/h12-16,18-19,28H,2-11H2,1H3/b25-16+ |
| InChIKey | TUELLLIYLRRNFW-PCLIKHOPSA-N |
| XLogP | 4.49 |
| TPSA | 85.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dicyclohexyl-6-hydroxy-5-[(4-methoxyphenyl)iminomethyl]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dicyclohexyl-6-hydroxy-5-[(4-methoxyphenyl)iminomethyl]pyrimidine-2,4-dione?
The IUPAC name of 1,3-dicyclohexyl-6-hydroxy-5-[(4-methoxyphenyl)iminomethyl]pyrimidine-2,4-dione (CID 1379444) is 1,3-dicyclohexyl-6-hydroxy-5-[(4-methoxyphenyl)iminomethyl]pyrimidine-2,4-dione.
What is the SMILES notation for 1,3-dicyclohexyl-6-hydroxy-5-[(4-methoxyphenyl)iminomethyl]pyrimidine-2,4-dione?
The canonical SMILES for 1,3-dicyclohexyl-6-hydroxy-5-[(4-methoxyphenyl)iminomethyl]pyrimidine-2,4-dione is COc1ccc(/N=C/c2c(O)n(C3CCCCC3)c(=O)n(C3CCCCC3)c2=O)cc1.
What is the InChIKey of 1,3-dicyclohexyl-6-hydroxy-5-[(4-methoxyphenyl)iminomethyl]pyrimidine-2,4-dione?
The InChIKey is TUELLLIYLRRNFW-PCLIKHOPSA-N. The full InChI is InChI=1S/C24H31N3O4/c1-31-20-14-12-17(13-15-20)25-16-21-22(28)26(18-8-4-2-5-9-18)24(30)27(23(21)29)19-10-6-3-7-11-19/h12-16,18-19,28H,2-11H2,1H3/b25-16+.
What are the key properties of 1,3-dicyclohexyl-6-hydroxy-5-[(4-methoxyphenyl)iminomethyl]pyrimidine-2,4-dione?
1,3-dicyclohexyl-6-hydroxy-5-[(4-methoxyphenyl)iminomethyl]pyrimidine-2,4-dione has a molecular weight of 425.53 g/mol, XLogP of 4.49, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dicyclohexyl-6-hydroxy-5-[(4-methoxyphenyl)iminomethyl]pyrimidine-2,4-dione is sourced from PubChem (CID 1379444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).