C10H6FNO2S — CID 1379720
(5Z)-5-[(3-fluorophenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 1379720) has the molecular formula C10H6FNO2S and a molecular weight of 223.23 g/mol. Its IUPAC name is (5Z)-5-[(3-fluorophenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(3-fluorophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 1379720 |
| Molecular Formula | C10H6FNO2S |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.01 |
| IUPAC Name | (5Z)-5-[(3-fluorophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2cccc(F)c2)S1 |
| InChI | InChI=1S/C10H6FNO2S/c11-7-3-1-2-6(4-7)5-8-9(13)12-10(14)15-8/h1-5H,(H,12,13,14)/b8-5- |
| InChIKey | FHRKKLBIQCOIMF-YVMONPNESA-N |
| XLogP | 2.15 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|