About 5-(1,3-benzodioxol-5-yliminomethyl)-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione
5-(1,3-benzodioxol-5-yliminomethyl)-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione (PubChem CID 1379778) has the molecular formula C18H12FN3O5
and a molecular weight of 369.31 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yliminomethyl)-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-(1,3-benzodioxol-5-yliminomethyl)-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione |
| PubChem CID | 1379778 |
| Molecular Formula | C18H12FN3O5 |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yliminomethyl)-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2ccccc2F)c(O)c1/C=N/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H12FN3O5/c19-12-3-1-2-4-13(12)22-17(24)11(16(23)21-18(22)25)8-20-10-5-6-14-15(7-10)27-9-26-14/h1-8,24H,9H2,(H,21,23,25)/b20-8+ |
| InChIKey | DWNYFIOGRFSSBU-DNTJNYDQSA-N |
| XLogP | 1.85 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-(1,3-benzodioxol-5-yliminomethyl)-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-benzodioxol-5-yliminomethyl)-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione?
The IUPAC name of 5-(1,3-benzodioxol-5-yliminomethyl)-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione (CID 1379778) is 5-(1,3-benzodioxol-5-yliminomethyl)-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione.
What is the SMILES notation for 5-(1,3-benzodioxol-5-yliminomethyl)-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione?
The canonical SMILES for 5-(1,3-benzodioxol-5-yliminomethyl)-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione is O=c1[nH]c(=O)n(-c2ccccc2F)c(O)c1/C=N/c1ccc2c(c1)OCO2.
What is the InChIKey of 5-(1,3-benzodioxol-5-yliminomethyl)-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione?
The InChIKey is DWNYFIOGRFSSBU-DNTJNYDQSA-N. The full InChI is InChI=1S/C18H12FN3O5/c19-12-3-1-2-4-13(12)22-17(24)11(16(23)21-18(22)25)8-20-10-5-6-14-15(7-10)27-9-26-14/h1-8,24H,9H2,(H,21,23,25)/b20-8+.
What are the key properties of 5-(1,3-benzodioxol-5-yliminomethyl)-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione?
5-(1,3-benzodioxol-5-yliminomethyl)-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione has a molecular weight of 369.31 g/mol, XLogP of 1.85, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-benzodioxol-5-yliminomethyl)-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione is sourced from PubChem (CID 1379778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).