About (2-tert-butyl-1,3-thiazol-5-yl)-(1,7-diazaspiro[3.5]nonan-7-yl)methanone
(2-tert-butyl-1,3-thiazol-5-yl)-(1,7-diazaspiro[3.5]nonan-7-yl)methanone (PubChem CID 138000124) has the molecular formula C15H23N3OS
and a molecular weight of 293.44 g/mol. Its IUPAC name is (2-tert-butyl-1,3-thiazol-5-yl)-(1,7-diazaspiro[3.5]nonan-7-yl)methanone.
Molecular Properties
| Compound Name | (2-tert-butyl-1,3-thiazol-5-yl)-(1,7-diazaspiro[3.5]nonan-7-yl)methanone |
| PubChem CID | 138000124 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | (2-tert-butyl-1,3-thiazol-5-yl)-(1,7-diazaspiro[3.5]nonan-7-yl)methanone |
| SMILES | CC(C)(C)c1ncc(C(=O)N2CCC3(CCN3)CC2)s1 |
| InChI | InChI=1S/C15H23N3OS/c1-14(2,3)13-16-10-11(20-13)12(19)18-8-5-15(6-9-18)4-7-17-15/h10,17H,4-9H2,1-3H3 |
| InChIKey | ANWSIOQBFQAVIP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-tert-butyl-1,3-thiazol-5-yl)-(1,7-diazaspiro[3.5]nonan-7-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-tert-butyl-1,3-thiazol-5-yl)-(1,7-diazaspiro[3.5]nonan-7-yl)methanone?
The IUPAC name of (2-tert-butyl-1,3-thiazol-5-yl)-(1,7-diazaspiro[3.5]nonan-7-yl)methanone (CID 138000124) is (2-tert-butyl-1,3-thiazol-5-yl)-(1,7-diazaspiro[3.5]nonan-7-yl)methanone.
What is the SMILES notation for (2-tert-butyl-1,3-thiazol-5-yl)-(1,7-diazaspiro[3.5]nonan-7-yl)methanone?
The canonical SMILES for (2-tert-butyl-1,3-thiazol-5-yl)-(1,7-diazaspiro[3.5]nonan-7-yl)methanone is CC(C)(C)c1ncc(C(=O)N2CCC3(CCN3)CC2)s1.
What is the InChIKey of (2-tert-butyl-1,3-thiazol-5-yl)-(1,7-diazaspiro[3.5]nonan-7-yl)methanone?
The InChIKey is ANWSIOQBFQAVIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3OS/c1-14(2,3)13-16-10-11(20-13)12(19)18-8-5-15(6-9-18)4-7-17-15/h10,17H,4-9H2,1-3H3.
What are the key properties of (2-tert-butyl-1,3-thiazol-5-yl)-(1,7-diazaspiro[3.5]nonan-7-yl)methanone?
(2-tert-butyl-1,3-thiazol-5-yl)-(1,7-diazaspiro[3.5]nonan-7-yl)methanone has a molecular weight of 293.44 g/mol, XLogP of 2.41, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-tert-butyl-1,3-thiazol-5-yl)-(1,7-diazaspiro[3.5]nonan-7-yl)methanone is sourced from PubChem (CID 138000124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).